C11H7N3O2 — CID 115004120
2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 115004120) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 115004120 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C11H7N3O2/c15-7-8-3-1-5-10-12-11(13-14(8)10)9-4-2-6-16-9/h1-7H |
| InChIKey | BONGKXAUYLJRBB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|