About 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine
6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 87492476) has the molecular formula C9H5BrN4O
and a molecular weight of 265.07 g/mol. Its IUPAC name is 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine.
Analyze 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine?
The IUPAC name of 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine (CID 87492476) is 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine.
What is the SMILES notation for 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine?
The canonical SMILES for 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine is Brc1cn2nc(-c3ccco3)nc2cn1.
What is the InChIKey of 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine?
The InChIKey is MNHNIGRTOJLXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN4O/c10-7-5-14-8(4-11-7)12-9(13-14)6-2-1-3-15-6/h1-5H.
What are the key properties of 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine?
6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine has a molecular weight of 265.07 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazine is sourced from PubChem (CID 87492476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).