C13H10N6O — CID 10706855
4-(furan-2-yl)-11-prop-2-enyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene (PubChem CID 10706855) has the molecular formula C13H10N6O and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(furan-2-yl)-11-prop-2-enyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene.
| Compound Name | 4-(furan-2-yl)-11-prop-2-enyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
|---|---|
| PubChem CID | 10706855 |
| Molecular Formula | C13H10N6O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(furan-2-yl)-11-prop-2-enyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
| SMILES | C=CCn1cc2c(ncn3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C13H10N6O/c1-2-5-18-7-9-11(16-18)14-8-19-13(9)15-12(17-19)10-4-3-6-20-10/h2-4,6-8H,1,5H2 |
| InChIKey | BUGFYDKFUQXHJN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|