C26H21N7O2 — CID 45481766
N-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-(4-phenylphenyl)acetamide (PubChem CID 45481766) has the molecular formula C26H21N7O2 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 45481766 |
| Molecular Formula | C26H21N7O2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-(4-phenylphenyl)acetamide |
| SMILES | CCn1cc2c(nc(NC(=O)Cc3ccc(-c4ccccc4)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C26H21N7O2/c1-2-32-16-20-23(30-32)29-26(33-25(20)28-24(31-33)21-9-6-14-35-21)27-22(34)15-17-10-12-19(13-11-17)18-7-4-3-5-8-18/h3-14,16H,2,15H2,1H3,(H,27,29,30,34) |
| InChIKey | JFIOINHSYJAPDF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |