C23H23Cl2N9O2 — CID 11016858
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]urea (PubChem CID 11016858) has the molecular formula C23H23Cl2N9O2 and a molecular weight of 528.40 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]urea |
|---|---|
| PubChem CID | 11016858 |
| Molecular Formula | C23H23Cl2N9O2 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]urea |
| SMILES | CCn1cc2c(nc(NC(=O)Nc3ccc(N(CCCl)CCCl)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C23H23Cl2N9O2/c1-2-33-14-17-19(30-33)28-22(34-21(17)27-20(31-34)18-4-3-13-36-18)29-23(35)26-15-5-7-16(8-6-15)32(11-9-24)12-10-25/h3-8,13-14H,2,9-12H2,1H3,(H2,26,28,29,30,35) |
| InChIKey | XHYAURQQCDPPEC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|