C29H34N10O5 — CID 140612770
tert-butyl N-[4-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]butyl]carbamate (PubChem CID 140612770) has the molecular formula C29H34N10O5 and a molecular weight of 602.66 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 140612770 |
| Molecular Formula | C29H34N10O5 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | tert-butyl N-[4-[[2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetyl]amino]butyl]carbamate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)NCCCCNC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C29H34N10O5/c1-29(2,3)44-28(42)31-14-6-5-13-30-22(40)16-18-9-11-19(12-10-18)32-27(41)35-26-34-23-20(17-38(4)36-23)25-33-24(37-39(25)26)21-8-7-15-43-21/h7-12,15,17H,5-6,13-14,16H2,1-4H3,(H,30,40)(H,31,42)(H2,32,34,35,36,41) |
| InChIKey | JAPTVUIYSSLZOH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|