C20H17N9O4 — CID 10884803
1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-nitrophenyl)urea (PubChem CID 10884803) has the molecular formula C20H17N9O4 and a molecular weight of 447.42 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 10884803 |
| Molecular Formula | C20H17N9O4 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-nitrophenyl)urea |
| SMILES | CCCn1cc2c(nc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C20H17N9O4/c1-2-9-27-11-14-16(25-27)23-19(28-18(14)22-17(26-28)15-4-3-10-33-15)24-20(30)21-12-5-7-13(8-6-12)29(31)32/h3-8,10-11H,2,9H2,1H3,(H2,21,23,24,25,30) |
| InChIKey | FMBRLWKPOKELMV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|