C17H17N7O3 — CID 146327842
ethyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-2-cyclopropylacetate (PubChem CID 146327842) has the molecular formula C17H17N7O3 and a molecular weight of 367.37 g/mol. Its IUPAC name is ethyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-2-cyclopropylacetate.
| Compound Name | ethyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 146327842 |
| Molecular Formula | C17H17N7O3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-2-cyclopropylacetate |
| SMILES | CCOC(=O)C(C1CC1)n1cc2c(nc(N)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C17H17N7O3/c1-2-26-16(25)12(9-5-6-9)23-8-10-13(21-23)20-17(18)24-15(10)19-14(22-24)11-4-3-7-27-11/h3-4,7-9,12H,2,5-6H2,1H3,(H2,18,20,21) |
| InChIKey | SUYBALYWALLSQF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |