C29H35N9O4 — CID 146328144
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]hexan-1-one (PubChem CID 146328144) has the molecular formula C29H35N9O4 and a molecular weight of 573.66 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 146328144 |
| Molecular Formula | C29H35N9O4 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCC(C(=O)N1CCN(c2ccc(OCCOC)cc2)CC1)n1cc2c(nc(N)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C29H35N9O4/c1-3-4-6-23(28(39)36-14-12-35(13-15-36)20-8-10-21(11-9-20)41-18-17-40-2)37-19-22-25(33-37)32-29(30)38-27(22)31-26(34-38)24-7-5-16-42-24/h5,7-11,16,19,23H,3-4,6,12-15,17-18H2,1-2H3,(H2,30,32,33) |
| InChIKey | KOLWRGGKDBVRFK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|