C29H35N9O6 — CID 146328057
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-3-methoxy-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]propan-1-one (PubChem CID 146328057) has the molecular formula C29H35N9O6 and a molecular weight of 605.66 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-3-methoxy-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-3-methoxy-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 146328057 |
| Molecular Formula | C29H35N9O6 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-3-methoxy-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]propan-1-one |
| SMILES | COCCOCCOc1ccc(N2CCN(C(=O)C(COC)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C29H35N9O6/c1-40-14-15-42-16-17-43-21-7-5-20(6-8-21)35-9-11-36(12-10-35)28(39)23(19-41-2)37-27-22(18-31-37)26-32-25(24-4-3-13-44-24)34-38(26)29(30)33-27/h3-8,13,18,23H,9-12,14-17,19H2,1-2H3,(H2,30,33) |
| InChIKey | ZWKJQOLJNHRVBK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|