C31H33N9O5S — CID 168655219
2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 168655219) has the molecular formula C31H33N9O5S and a molecular weight of 643.73 g/mol. Its IUPAC name is 2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168655219 |
| Molecular Formula | C31H33N9O5S |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(N3CCN(CCn4ncc5c4nc(N)n4nc(-c6ccco6)nc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H33N9O5S/c1-22-4-10-25(11-5-22)46(41,42)45-20-19-43-24-8-6-23(7-9-24)38-15-12-37(13-16-38)14-17-39-29-26(21-33-39)30-34-28(27-3-2-18-44-27)36-40(30)31(32)35-29/h2-11,18,21H,12-17,19-20H2,1H3,(H2,32,35) |
| InChIKey | YGDNGCDYLDHCQA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|