C17H18N8O2 — CID 21363908
1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-one (PubChem CID 21363908) has the molecular formula C17H18N8O2 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-one.
| Compound Name | 1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-one |
|---|---|
| PubChem CID | 21363908 |
| Molecular Formula | C17H18N8O2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-one |
| SMILES | Nc1nc2c(cnn2CCN2CCC(=O)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C17H18N8O2/c18-17-21-15-12(16-20-14(22-25(16)17)13-2-1-9-27-13)10-19-24(15)8-7-23-5-3-11(26)4-6-23/h1-2,9-10H,3-8H2,(H2,18,21) |
| InChIKey | KFLRMMAWONSIPM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |