C19H15N7O3 — CID 21220572
10-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 21220572) has the molecular formula C19H15N7O3 and a molecular weight of 389.38 g/mol. Its IUPAC name is 10-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 21220572 |
| Molecular Formula | C19H15N7O3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 10-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCc2ccc3c(c2)OCO3)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C19H15N7O3/c20-19-23-17-12(18-22-16(24-26(18)19)14-2-1-7-27-14)9-21-25(17)6-5-11-3-4-13-15(8-11)29-10-28-13/h1-4,7-9H,5-6,10H2,(H2,20,23) |
| InChIKey | SDAKDJXVXXIFCV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |