C20H25N9O3 — CID 20785217
3-[[1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-ylidene]amino]oxypropan-1-ol (PubChem CID 20785217) has the molecular formula C20H25N9O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-[[1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-ylidene]amino]oxypropan-1-ol.
| Compound Name | 3-[[1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-ylidene]amino]oxypropan-1-ol |
|---|---|
| PubChem CID | 20785217 |
| Molecular Formula | C20H25N9O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[[1-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperidin-4-ylidene]amino]oxypropan-1-ol |
| SMILES | Nc1nc2c(cnn2CCN2CCC(=NOCCCO)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C20H25N9O3/c21-20-24-18-15(19-23-17(25-29(19)20)16-3-1-11-31-16)13-22-28(18)9-8-27-6-4-14(5-7-27)26-32-12-2-10-30/h1,3,11,13,30H,2,4-10,12H2,(H2,21,24) |
| InChIKey | XBDKMHRTVRVYGM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|