C26H30FN11O3 — CID 146468375
N-(2-aminoethyl)-2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]acetamide (PubChem CID 146468375) has the molecular formula C26H30FN11O3 and a molecular weight of 563.60 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]acetamide |
|---|---|
| PubChem CID | 146468375 |
| Molecular Formula | C26H30FN11O3 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]acetamide |
| SMILES | NCCNC(=O)COc1ccc(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c(F)c1 |
| InChI | InChI=1S/C26H30FN11O3/c27-19-14-17(41-16-22(39)30-6-5-28)3-4-20(19)36-10-7-35(8-11-36)9-12-37-24-18(15-31-37)25-32-23(21-2-1-13-40-21)34-38(25)26(29)33-24/h1-4,13-15H,5-12,16,28H2,(H2,29,33)(H,30,39) |
| InChIKey | KCZSPMNIKZZEAR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 170.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|