C27H31FN10O3 — CID 146468269
10-[2-[4-[2-fluoro-4-(morpholin-3-ylmethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 146468269) has the molecular formula C27H31FN10O3 and a molecular weight of 562.61 g/mol. Its IUPAC name is 10-[2-[4-[2-fluoro-4-(morpholin-3-ylmethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[2-[4-[2-fluoro-4-(morpholin-3-ylmethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 146468269 |
| Molecular Formula | C27H31FN10O3 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 10-[2-[4-[2-fluoro-4-(morpholin-3-ylmethoxy)phenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCN2CCN(c3ccc(OCC4COCCN4)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H31FN10O3/c28-21-14-19(41-17-18-16-39-13-5-30-18)3-4-22(21)36-9-6-35(7-10-36)8-11-37-25-20(15-31-37)26-32-24(23-2-1-12-40-23)34-38(26)27(29)33-25/h1-4,12,14-15,18,30H,5-11,13,16-17H2,(H2,29,33) |
| InChIKey | GZIXXCUTFQYHCE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|