C31H39N9O5 — CID 146327961
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 146327961) has the molecular formula C31H39N9O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 146327961 |
| Molecular Formula | C31H39N9O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | COCCOCCOc1ccc(N2CCN(C(=O)C(CC(C)C)n3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C31H39N9O5/c1-21(2)19-25(39-29-24(20-33-39)28-34-27(26-5-4-14-45-26)36-40(28)31(32)35-29)30(41)38-12-10-37(11-13-38)22-6-8-23(9-7-22)44-18-17-43-16-15-42-3/h4-9,14,20-21,25H,10-13,15-19H2,1-3H3,(H2,32,35) |
| InChIKey | IPQGMSAANDYSJV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|