C33H34N8O5 — CID 146328084
2-[4-(furan-2-yl)-7-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 146328084) has the molecular formula C33H34N8O5 and a molecular weight of 622.69 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-7-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(furan-2-yl)-7-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 146328084 |
| Molecular Formula | C33H34N8O5 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 2-[4-(furan-2-yl)-7-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)C(c3ccccc3OC)n3ncc4c3nc(C)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C33H34N8O5/c1-22-35-31-26(32-36-30(37-40(22)32)28-9-6-18-46-28)21-34-41(31)29(25-7-4-5-8-27(25)44-3)33(42)39-16-14-38(15-17-39)23-10-12-24(13-11-23)45-20-19-43-2/h4-13,18,21,29H,14-17,19-20H2,1-3H3 |
| InChIKey | QCZPRUXYUGMELJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|