C27H24N8O3 — CID 166178117
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(2-ethoxyphenyl)methyl]-2-phenylacetamide (PubChem CID 166178117) has the molecular formula C27H24N8O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(2-ethoxyphenyl)methyl]-2-phenylacetamide.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(2-ethoxyphenyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 166178117 |
| Molecular Formula | C27H24N8O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(2-ethoxyphenyl)methyl]-2-phenylacetamide |
| SMILES | CCOc1ccccc1CNC(=O)C(c1ccccc1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C27H24N8O3/c1-2-37-20-12-7-6-11-18(20)15-29-26(36)22(17-9-4-3-5-10-17)34-25-19(16-30-34)24-31-23(21-13-8-14-38-21)33-35(24)27(28)32-25/h3-14,16,22H,2,15H2,1H3,(H2,28,32)(H,29,36) |
| InChIKey | IJMIUXMZOPJJAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |