C19H16N8O2 — CID 146186369
(2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-methyl-2-phenylacetamide (PubChem CID 146186369) has the molecular formula C19H16N8O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-methyl-2-phenylacetamide.
| Compound Name | (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 146186369 |
| Molecular Formula | C19H16N8O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)[C@H](c1ccccc1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C19H16N8O2/c1-21-18(28)14(11-6-3-2-4-7-11)26-17-12(10-22-26)16-23-15(13-8-5-9-29-13)25-27(16)19(20)24-17/h2-10,14H,1H3,(H2,20,24)(H,21,28)/t14-/m0/s1 |
| InChIKey | YPLCTRRGZGFGAI-AWEZNQCLSA-N |
| XLogP | 1.65 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |