C25H26N8O3 — CID 150310784
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(3-hydroxycyclohexyl)-2-phenylpropanamide (PubChem CID 150310784) has the molecular formula C25H26N8O3 and a molecular weight of 486.54 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(3-hydroxycyclohexyl)-2-phenylpropanamide.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(3-hydroxycyclohexyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 150310784 |
| Molecular Formula | C25H26N8O3 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(3-hydroxycyclohexyl)-2-phenylpropanamide |
| SMILES | CC(C(=O)NC1CCCC(O)C1)(c1ccccc1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C25H26N8O3/c1-25(15-7-3-2-4-8-15,23(35)28-16-9-5-10-17(34)13-16)33-22-18(14-27-33)21-29-20(19-11-6-12-36-19)31-32(21)24(26)30-22/h2-4,6-8,11-12,14,16-17,34H,5,9-10,13H2,1H3,(H2,26,30)(H,28,35) |
| InChIKey | GLONEDDIWFRVMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |