C26H28N8O3 — CID 146186381
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(4-hydroxycycloheptyl)-2-phenylpropanamide (PubChem CID 146186381) has the molecular formula C26H28N8O3 and a molecular weight of 500.56 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(4-hydroxycycloheptyl)-2-phenylpropanamide.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(4-hydroxycycloheptyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 146186381 |
| Molecular Formula | C26H28N8O3 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-(4-hydroxycycloheptyl)-2-phenylpropanamide |
| SMILES | CC(C(=O)NC1CCCC(O)CC1)(c1ccccc1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C26H28N8O3/c1-26(16-7-3-2-4-8-16,24(36)29-17-9-5-10-18(35)13-12-17)34-23-19(15-28-34)22-30-21(20-11-6-14-37-20)32-33(22)25(27)31-23/h2-4,6-8,11,14-15,17-18,35H,5,9-10,12-13H2,1H3,(H2,27,31)(H,29,36) |
| InChIKey | UEVXYIOKIGQYRS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |