C18H12FN7O2 — CID 146327966
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(4-fluorophenyl)acetaldehyde (PubChem CID 146327966) has the molecular formula C18H12FN7O2 and a molecular weight of 377.34 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(4-fluorophenyl)acetaldehyde.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(4-fluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 146327966 |
| Molecular Formula | C18H12FN7O2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(4-fluorophenyl)acetaldehyde |
| SMILES | Nc1nc2c(cnn2C(C=O)c2ccc(F)cc2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H12FN7O2/c19-11-5-3-10(4-6-11)13(9-27)25-17-12(8-21-25)16-22-15(14-2-1-7-28-14)24-26(16)18(20)23-17/h1-9,13H,(H2,20,23) |
| InChIKey | RWVLNKDQNATBAD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|