C18H11F2N7O3 — CID 146327676
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3,4-difluorophenyl)acetic acid (PubChem CID 146327676) has the molecular formula C18H11F2N7O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3,4-difluorophenyl)acetic acid.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 146327676 |
| Molecular Formula | C18H11F2N7O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3,4-difluorophenyl)acetic acid |
| SMILES | Nc1nc2c(cnn2C(C(=O)O)c2ccc(F)c(F)c2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H11F2N7O3/c19-10-4-3-8(6-11(10)20)13(17(28)29)26-16-9(7-22-26)15-23-14(12-2-1-5-30-12)25-27(15)18(21)24-16/h1-7,13H,(H2,21,24)(H,28,29) |
| InChIKey | UBZHFCMXAVKRER-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |