C12H8N6O — CID 14458845
4-(furan-2-yl)-3,5,6,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-7-amine (PubChem CID 14458845) has the molecular formula C12H8N6O and a molecular weight of 252.24 g/mol. Its IUPAC name is 4-(furan-2-yl)-3,5,6,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-7-amine.
| Compound Name | 4-(furan-2-yl)-3,5,6,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 14458845 |
| Molecular Formula | C12H8N6O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 4-(furan-2-yl)-3,5,6,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-7-amine |
| SMILES | Nc1nc2ccncc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C12H8N6O/c13-12-15-8-3-4-14-6-7(8)11-16-10(17-18(11)12)9-2-1-5-19-9/h1-6H,(H2,13,15) |
| InChIKey | PVMUALAPGAXYFE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |