C35H38N10O3 — CID 146328125
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-phenyl-1-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-1-yl]ethanone (PubChem CID 146328125) has the molecular formula C35H38N10O3 and a molecular weight of 646.76 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-phenyl-1-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-phenyl-1-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 146328125 |
| Molecular Formula | C35H38N10O3 |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-phenyl-1-[4-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-1-yl]ethanone |
| SMILES | Nc1nc2c(cnn2C(C(=O)N2CCN(c3ccc(OCCCN4CCCC4)cc3)CC2)c2ccccc2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C35H38N10O3/c36-35-39-33-28(32-38-31(40-45(32)35)29-10-6-22-48-29)24-37-44(33)30(25-8-2-1-3-9-25)34(46)43-20-18-42(19-21-43)26-11-13-27(14-12-26)47-23-7-17-41-15-4-5-16-41/h1-3,6,8-14,22,24,30H,4-5,7,15-21,23H2,(H2,36,39) |
| InChIKey | DSVIQWOUBADUNA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|