C19H14FN7O3 — CID 146327986
methyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3-fluorophenyl)acetate (PubChem CID 146327986) has the molecular formula C19H14FN7O3 and a molecular weight of 407.37 g/mol. Its IUPAC name is methyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3-fluorophenyl)acetate.
| Compound Name | methyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 146327986 |
| Molecular Formula | C19H14FN7O3 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | methyl 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-2-(3-fluorophenyl)acetate |
| SMILES | COC(=O)C(c1cccc(F)c1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C19H14FN7O3/c1-29-18(28)14(10-4-2-5-11(20)8-10)26-17-12(9-22-26)16-23-15(13-6-3-7-30-13)25-27(16)19(21)24-17/h2-9,14H,1H3,(H2,21,24) |
| InChIKey | ISIQRWJIHLTKKX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |