C29H37N9O5 — CID 166765568
2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]butan-1-one (PubChem CID 166765568) has the molecular formula C29H37N9O5 and a molecular weight of 591.67 g/mol. Its IUPAC name is 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 166765568 |
| Molecular Formula | C29H37N9O5 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]piperazin-1-yl]butan-1-one |
| SMILES | [H]/N=C/c1c(NC(CC)C(=O)N2CCN(c3ccc(OCCOCCOC)cc3)CC2)nc(N)n2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C29H37N9O5/c1-3-23(32-25-22(19-30)27-33-26(24-5-4-14-43-24)35-38(27)29(31)34-25)28(39)37-12-10-36(11-13-37)20-6-8-21(9-7-20)42-18-17-41-16-15-40-2/h4-9,14,19,23,30,32H,3,10-13,15-18H2,1-2H3,(H2,31,34)/b30-19+ |
| InChIKey | NKHQHDQZQDCCMN-NDZAJKAJSA-N |
| XLogP | 2.55 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|