C28H32F3N9O4 — CID 162564164
5-amino-8-(furan-2-yl)-3-[2-[4-[4-(3-methoxypropoxy)phenyl]piperazin-1-yl]ethyl]-1-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[5,1-f]purin-2-one (PubChem CID 162564164) has the molecular formula C28H32F3N9O4 and a molecular weight of 615.62 g/mol. Its IUPAC name is 5-amino-8-(furan-2-yl)-3-[2-[4-[4-(3-methoxypropoxy)phenyl]piperazin-1-yl]ethyl]-1-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[5,1-f]purin-2-one.
| Compound Name | 5-amino-8-(furan-2-yl)-3-[2-[4-[4-(3-methoxypropoxy)phenyl]piperazin-1-yl]ethyl]-1-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[5,1-f]purin-2-one |
|---|---|
| PubChem CID | 162564164 |
| Molecular Formula | C28H32F3N9O4 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 5-amino-8-(furan-2-yl)-3-[2-[4-[4-(3-methoxypropoxy)phenyl]piperazin-1-yl]ethyl]-1-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[5,1-f]purin-2-one |
| SMILES | COCCCOc1ccc(N2CCN(CCn3c(=O)n(CC(F)(F)F)c4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1 |
| InChI | InChI=1S/C28H32F3N9O4/c1-42-15-3-17-43-20-7-5-19(6-8-20)37-12-9-36(10-13-37)11-14-38-24-22(39(27(38)41)18-28(29,30)31)25-33-23(21-4-2-16-44-21)35-40(25)26(32)34-24/h2,4-8,16H,3,9-15,17-18H2,1H3,(H2,32,34) |
| InChIKey | LKKAXRLHQHINBM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|