C26H31F3N8O3 — CID 16679244
2-(furan-2-yl)-7-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-7-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (PubChem CID 16679244) has the molecular formula C26H31F3N8O3 and a molecular weight of 560.58 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-7-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-7-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-7-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 16679244 |
| Molecular Formula | C26H31F3N8O3 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-(furan-2-yl)-7-N-[2-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]ethyl]-7-N-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| SMILES | COCCOc1ccc(N2CCN(CCN(CC(F)(F)F)c3cc4nc(-c5ccco5)nn4c(N)n3)CC2)cc1 |
| InChI | InChI=1S/C26H31F3N8O3/c1-38-15-16-39-20-6-4-19(5-7-20)35-11-8-34(9-12-35)10-13-36(18-26(27,28)29)22-17-23-31-24(21-3-2-14-40-21)33-37(23)25(30)32-22/h2-7,14,17H,8-13,15-16,18H2,1H3,(H2,30,32) |
| InChIKey | YZGRYHMIXFZIDT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|