C26H31N9O4 — CID 146327945
2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 146327945) has the molecular formula C26H31N9O4 and a molecular weight of 533.59 g/mol. Its IUPAC name is 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 146327945 |
| Molecular Formula | C26H31N9O4 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 2-[[5-amino-2-(furan-2-yl)-8-methanimidoyl-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]amino]-1-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | [H]/N=C/c1c(NC(C)C(=O)N2CCN(c3ccc(OCCOC)cc3)CC2)nc(N)n2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C26H31N9O4/c1-17(25(36)34-11-9-33(10-12-34)18-5-7-19(8-6-18)38-15-14-37-2)29-22-20(16-27)24-30-23(21-4-3-13-39-21)32-35(24)26(28)31-22/h3-8,13,16-17,27,29H,9-12,14-15H2,1-2H3,(H2,28,31)/b27-16+ |
| InChIKey | ZXLWSWQFSCUKSV-JVWAILMASA-N |
| XLogP | 2.14 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|