C18H15N7O2 — CID 21220573
4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]ethyl]phenol (PubChem CID 21220573) has the molecular formula C18H15N7O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]ethyl]phenol.
| Compound Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]ethyl]phenol |
|---|---|
| PubChem CID | 21220573 |
| Molecular Formula | C18H15N7O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-11-yl]ethyl]phenol |
| SMILES | Nc1nc2nn(CCc3ccc(O)cc3)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H15N7O2/c19-18-21-15-13(17-20-16(23-25(17)18)14-2-1-9-27-14)10-24(22-15)8-7-11-3-5-12(26)6-4-11/h1-6,9-10,26H,7-8H2,(H2,19,21,22) |
| InChIKey | QZVSEKATJHPJBC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |