C18H18N6O2 — CID 163927085
4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]butyl]phenol (PubChem CID 163927085) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]butyl]phenol.
| Compound Name | 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]butyl]phenol |
|---|---|
| PubChem CID | 163927085 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-[4-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]butyl]phenol |
| SMILES | Nc1nc(CCCCc2ccc(O)cc2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H18N6O2/c19-17-20-15(6-2-1-4-12-7-9-13(25)10-8-12)21-18-22-16(23-24(17)18)14-5-3-11-26-14/h3,5,7-11,25H,1-2,4,6H2,(H2,19,20,21,22,23) |
| InChIKey | RFKPNVYJNICBKI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|