C11H10N6O2 — CID 159141943
3-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]propanal (PubChem CID 159141943) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]propanal.
| Compound Name | 3-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]propanal |
|---|---|
| PubChem CID | 159141943 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]propanal |
| SMILES | Nc1nc(CCC=O)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C11H10N6O2/c12-10-13-8(4-1-5-18)14-11-15-9(16-17(10)11)7-3-2-6-19-7/h2-3,5-6H,1,4H2,(H2,12,13,14,15,16) |
| InChIKey | DKGNWVNEWLUCBF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|