C10H12N8O — CID 51051139
5-N-(2-aminoethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 51051139) has the molecular formula C10H12N8O and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-N-(2-aminoethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 5-N-(2-aminoethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 51051139 |
| Molecular Formula | C10H12N8O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-N-(2-aminoethyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | NCCNc1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C10H12N8O/c11-3-4-13-9-15-8(12)18-10(16-9)14-7(17-18)6-2-1-5-19-6/h1-2,5H,3-4,11H2,(H3,12,13,14,15,16,17) |
| InChIKey | TUHMQVOAPJOLNG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 133.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |