C22H25N9O2 — CID 147098302
N-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylacetamide (PubChem CID 147098302) has the molecular formula C22H25N9O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 147098302 |
| Molecular Formula | C22H25N9O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-2-pyrrolidin-1-ylacetamide |
| SMILES | Nc1nc(NCCc2ccc(NC(=O)CN3CCCC3)cc2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H25N9O2/c23-20-27-21(28-22-26-19(29-31(20)22)17-4-3-13-33-17)24-10-9-15-5-7-16(8-6-15)25-18(32)14-30-11-1-2-12-30/h3-8,13H,1-2,9-12,14H2,(H,25,32)(H3,23,24,26,27,28,29) |
| InChIKey | BKDVOWGDZXWAEB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |