C24H27N7O3 — CID 160937916
2-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-1-(4-methyloxan-4-yl)ethanone (PubChem CID 160937916) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-1-(4-methyloxan-4-yl)ethanone.
| Compound Name | 2-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-1-(4-methyloxan-4-yl)ethanone |
|---|---|
| PubChem CID | 160937916 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl]-1-(4-methyloxan-4-yl)ethanone |
| SMILES | CC1(C(=O)Cc2ccc(CCNc3nc(N)n4nc(-c5ccco5)nc4n3)cc2)CCOCC1 |
| InChI | InChI=1S/C24H27N7O3/c1-24(9-13-33-14-10-24)19(32)15-17-6-4-16(5-7-17)8-11-26-22-28-21(25)31-23(29-22)27-20(30-31)18-3-2-12-34-18/h2-7,12H,8-11,13-15H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | YMSUPYOIPYCJGF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |