C21H23N7O3 — CID 15730022
[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 15730022) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15730022 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C21H23N7O3/c1-21(2,3)17(29)31-14-8-6-13(7-9-14)10-11-23-19-25-18(22)28-20(26-19)24-16(27-28)15-5-4-12-30-15/h4-9,12H,10-11H2,1-3H3,(H3,22,23,24,25,26,27) |
| InChIKey | HVLMCAZXUDCKKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|