C20H25N11O — CID 153381381
4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-[amino(propan-2-yl)amino]benzenecarboximidamide (PubChem CID 153381381) has the molecular formula C20H25N11O and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-[amino(propan-2-yl)amino]benzenecarboximidamide.
| Compound Name | 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-[amino(propan-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 153381381 |
| Molecular Formula | C20H25N11O |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]-N'-[amino(propan-2-yl)amino]benzenecarboximidamide |
| SMILES | CC(C)N(N)/N=C(\N)c1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C20H25N11O/c1-12(2)31(23)28-16(21)14-7-5-13(6-8-14)9-10-24-19-26-18(22)30-20(27-19)25-17(29-30)15-4-3-11-32-15/h3-8,11-12H,9-10,23H2,1-2H3,(H2,21,28)(H3,22,24,25,26,27,29) |
| InChIKey | NFLMNEUNMONLON-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 174.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|