C16H18N8O — CID 166752469
2-(furan-2-yl)-5-N-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-3,5-dienyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 166752469) has the molecular formula C16H18N8O and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-3,5-dienyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-3,5-dienyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 166752469 |
| Molecular Formula | C16H18N8O |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(furan-2-yl)-5-N-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-3,5-dienyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | C=N/C=C\C=C(/C)CCNc1nc(N)n2nc(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C16H18N8O/c1-11(5-3-8-18-2)7-9-19-15-21-14(17)24-16(22-15)20-13(23-24)12-6-4-10-25-12/h3-6,8,10H,2,7,9H2,1H3,(H3,17,19,20,21,22,23)/b8-3-,11-5+ |
| InChIKey | PGUPLTIJAVETKG-QKGSAJFTSA-N |
| XLogP | 2.32 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|