C18H23F2N9O2 — CID 171744927
(2S)-2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]-1-[4-(2,2-difluoropropyl)piperazin-1-yl]propan-1-one (PubChem CID 171744927) has the molecular formula C18H23F2N9O2 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2S)-2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]-1-[4-(2,2-difluoropropyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]-1-[4-(2,2-difluoropropyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 171744927 |
| Molecular Formula | C18H23F2N9O2 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (2S)-2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]-1-[4-(2,2-difluoropropyl)piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](Nc1nc(N)n2nc(-c3ccco3)nc2n1)C(=O)N1CCN(CC(C)(F)F)CC1 |
| InChI | InChI=1S/C18H23F2N9O2/c1-11(14(30)28-7-5-27(6-8-28)10-18(2,19)20)22-16-24-15(21)29-17(25-16)23-13(26-29)12-4-3-9-31-12/h3-4,9,11H,5-8,10H2,1-2H3,(H3,21,22,23,24,25,26)/t11-/m0/s1 |
| InChIKey | LXIUZYBGFUCKNE-NSHDSACASA-N |
| XLogP | 0.96 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |