C18H24N8O3 — CID 118726012
tert-butyl 4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidine-1-carboxylate (PubChem CID 118726012) has the molecular formula C18H24N8O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is tert-butyl 4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118726012 |
| Molecular Formula | C18H24N8O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl 4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C18H24N8O3/c1-18(2,3)29-17(27)25-8-6-11(7-9-25)20-15-22-14(19)26-16(23-15)21-13(24-26)12-5-4-10-28-12/h4-5,10-11H,6-9H2,1-3H3,(H3,19,20,21,22,23,24) |
| InChIKey | KQOARTFWPWTKKH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |