C23H25N9O2 — CID 118726016
4-[2-[4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidin-1-yl]ethyl]-1,3-dihydroindol-2-one (PubChem CID 118726016) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-[2-[4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidin-1-yl]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-[2-[4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidin-1-yl]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 118726016 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-[2-[4-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]piperidin-1-yl]ethyl]-1,3-dihydroindol-2-one |
| SMILES | Nc1nc(NC2CCN(CCc3cccc4c3CC(=O)N4)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H25N9O2/c24-21-28-22(29-23-27-20(30-32(21)23)18-5-2-12-34-18)25-15-7-10-31(11-8-15)9-6-14-3-1-4-17-16(14)13-19(33)26-17/h1-5,12,15H,6-11,13H2,(H,26,33)(H3,24,25,27,28,29,30) |
| InChIKey | ZOWFSAKWXNDEGI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |