C24H29N9O2 — CID 118726010
4-[2-[3-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]propyl-propylamino]ethyl]-1,3-dihydroindol-2-one (PubChem CID 118726010) has the molecular formula C24H29N9O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 4-[2-[3-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]propyl-propylamino]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-[2-[3-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]propyl-propylamino]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 118726010 |
| Molecular Formula | C24H29N9O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 4-[2-[3-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]propyl-propylamino]ethyl]-1,3-dihydroindol-2-one |
| SMILES | CCCN(CCCNc1nc(N)n2nc(-c3ccco3)nc2n1)CCc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C24H29N9O2/c1-2-11-32(13-9-16-6-3-7-18-17(16)15-20(34)27-18)12-5-10-26-23-29-22(25)33-24(30-23)28-21(31-33)19-8-4-14-35-19/h3-4,6-8,14H,2,5,9-13,15H2,1H3,(H,27,34)(H3,25,26,28,29,30,31) |
| InChIKey | LPQJVVVCQKYAIY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|