C19H24N8O3 — CID 68685842
tert-butyl 1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 68685842) has the molecular formula C19H24N8O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is tert-butyl 1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 68685842 |
| Molecular Formula | C19H24N8O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl 1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCN(c3nc(N)n4nc(-c5ccco5)nc4n3)C2C1 |
| InChI | InChI=1S/C19H24N8O3/c1-19(2,3)30-18(28)25-9-11-6-7-26(12(11)10-25)16-22-15(20)27-17(23-16)21-14(24-27)13-5-4-8-29-13/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H2,20,21,22,23,24) |
| InChIKey | OTYIYNBEPQLMTQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |