C24H23N9O — CID 68685821
2-(furan-2-yl)-5-[1-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 68685821) has the molecular formula C24H23N9O and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[1-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[1-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 68685821 |
| Molecular Formula | C24H23N9O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-(furan-2-yl)-5-[1-(quinolin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CC3CCN(Cc4ccc5ccccc5n4)C3C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H23N9O/c25-22-28-23(29-24-27-21(30-33(22)24)20-6-3-11-34-20)32-12-16-9-10-31(19(16)14-32)13-17-8-7-15-4-1-2-5-18(15)26-17/h1-8,11,16,19H,9-10,12-14H2,(H2,25,27,28,29,30) |
| InChIKey | MSEKLMGPGUDEIN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |