C18H17Cl2N9O — CID 11224613
5-[4-[(2,4-dichloro-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11224613) has the molecular formula C18H17Cl2N9O and a molecular weight of 446.30 g/mol. Its IUPAC name is 5-[4-[(2,4-dichloro-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-[4-[(2,4-dichloro-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11224613 |
| Molecular Formula | C18H17Cl2N9O |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 5-[4-[(2,4-dichloro-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3c(Cl)ccnc3Cl)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H17Cl2N9O/c19-12-3-4-22-14(20)11(12)10-27-5-7-28(8-6-27)17-24-16(21)29-18(25-17)23-15(26-29)13-2-1-9-30-13/h1-4,9H,5-8,10H2,(H2,21,23,24,25,26) |
| InChIKey | YXEGNERUPOXDCE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|