C24H29N9O — CID 169210655
2-(furan-2-yl)-5-[(3R)-3-[(4-pyridin-4-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169210655) has the molecular formula C24H29N9O and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[(3R)-3-[(4-pyridin-4-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[(3R)-3-[(4-pyridin-4-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169210655 |
| Molecular Formula | C24H29N9O |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 2-(furan-2-yl)-5-[(3R)-3-[(4-pyridin-4-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCC[C@H](CN3CCC(c4ccncc4)CC3)C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C24H29N9O/c25-22-28-23(29-24-27-21(30-33(22)24)20-4-2-14-34-20)32-11-1-3-17(16-32)15-31-12-7-19(8-13-31)18-5-9-26-10-6-18/h2,4-6,9-10,14,17,19H,1,3,7-8,11-13,15-16H2,(H2,25,27,28,29,30)/t17-/m1/s1 |
| InChIKey | VCZILGJNNUJDHE-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |