C23H27N11O3 — CID 169210602
2-(furan-2-yl)-5-[3-[[4-(3-nitro-4-pyridinyl)piperazin-1-yl]methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169210602) has the molecular formula C23H27N11O3 and a molecular weight of 505.54 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[3-[[4-(3-nitro-4-pyridinyl)piperazin-1-yl]methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[3-[[4-(3-nitro-4-pyridinyl)piperazin-1-yl]methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169210602 |
| Molecular Formula | C23H27N11O3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2-(furan-2-yl)-5-[3-[[4-(3-nitro-4-pyridinyl)piperazin-1-yl]methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCCC(CN3CCN(c4ccncc4[N+](=O)[O-])CC3)C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H27N11O3/c24-21-27-22(28-23-26-20(29-33(21)23)19-4-2-12-37-19)32-7-1-3-16(15-32)14-30-8-10-31(11-9-30)17-5-6-25-13-18(17)34(35)36/h2,4-6,12-13,16H,1,3,7-11,14-15H2,(H2,24,26,27,28,29) |
| InChIKey | YVNRQZBQTQFVIF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|