C23H29N9O — CID 170164174
2-(furan-2-yl)-5-[3-[(4-pyrrol-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 170164174) has the molecular formula C23H29N9O and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[3-[(4-pyrrol-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[3-[(4-pyrrol-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 170164174 |
| Molecular Formula | C23H29N9O |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-(furan-2-yl)-5-[3-[(4-pyrrol-1-ylpiperidin-1-yl)methyl]piperidin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCCC(CN3CCC(n4cccc4)CC3)C2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C23H29N9O/c24-21-26-22(27-23-25-20(28-32(21)23)19-6-4-14-33-19)31-11-3-5-17(16-31)15-29-12-7-18(8-13-29)30-9-1-2-10-30/h1-2,4,6,9-10,14,17-18H,3,5,7-8,11-13,15-16H2,(H2,24,25,26,27,28) |
| InChIKey | POZNOUQCOLLBSV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |